C25H22ClN3O — CID 20854553
N-[(4-chlorophenyl)methyl]-2-(3,5-dimethylanilino)quinoline-4-carboxamide (PubChem CID 20854553) has the molecular formula C25H22ClN3O and a molecular weight of 415.92 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-(3,5-dimethylanilino)quinoline-4-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-(3,5-dimethylanilino)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 20854553 |
| Molecular Formula | C25H22ClN3O |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-(3,5-dimethylanilino)quinoline-4-carboxamide |
| SMILES | Cc1cc(C)cc(Nc2cc(C(=O)NCc3ccc(Cl)cc3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C25H22ClN3O/c1-16-11-17(2)13-20(12-16)28-24-14-22(21-5-3-4-6-23(21)29-24)25(30)27-15-18-7-9-19(26)10-8-18/h3-14H,15H2,1-2H3,(H,27,30)(H,28,29) |
| InChIKey | RXNVTANJLHIJPT-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |