C23H16Cl2N2O — CID 4632644
6-chloro-N-[(4-chlorophenyl)methyl]-2-phenylquinoline-4-carboxamide (PubChem CID 4632644) has the molecular formula C23H16Cl2N2O and a molecular weight of 407.30 g/mol. Its IUPAC name is 6-chloro-N-[(4-chlorophenyl)methyl]-2-phenylquinoline-4-carboxamide.
| Compound Name | 6-chloro-N-[(4-chlorophenyl)methyl]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 4632644 |
| Molecular Formula | C23H16Cl2N2O |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 6-chloro-N-[(4-chlorophenyl)methyl]-2-phenylquinoline-4-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)c1cc(-c2ccccc2)nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C23H16Cl2N2O/c24-17-8-6-15(7-9-17)14-26-23(28)20-13-22(16-4-2-1-3-5-16)27-21-11-10-18(25)12-19(20)21/h1-13H,14H2,(H,26,28) |
| InChIKey | GLCCALVTVATQPC-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |