C26H25N3O2 — CID 20854390
2-(4-methoxyanilino)-N-[2-(4-methylphenyl)ethyl]quinoline-4-carboxamide (PubChem CID 20854390) has the molecular formula C26H25N3O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 2-(4-methoxyanilino)-N-[2-(4-methylphenyl)ethyl]quinoline-4-carboxamide.
| Compound Name | 2-(4-methoxyanilino)-N-[2-(4-methylphenyl)ethyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 20854390 |
| Molecular Formula | C26H25N3O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 2-(4-methoxyanilino)-N-[2-(4-methylphenyl)ethyl]quinoline-4-carboxamide |
| SMILES | COc1ccc(Nc2cc(C(=O)NCCc3ccc(C)cc3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C26H25N3O2/c1-18-7-9-19(10-8-18)15-16-27-26(30)23-17-25(29-24-6-4-3-5-22(23)24)28-20-11-13-21(31-2)14-12-20/h3-14,17H,15-16H2,1-2H3,(H,27,30)(H,28,29) |
| InChIKey | UOUZESTWBMNFDD-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |