C27H27N3O4 — CID 20854384
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-methoxyanilino)quinoline-4-carboxamide (PubChem CID 20854384) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-methoxyanilino)quinoline-4-carboxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-methoxyanilino)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 20854384 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-methoxyanilino)quinoline-4-carboxamide |
| SMILES | COc1ccc(Nc2cc(C(=O)NCCc3ccc(OC)c(OC)c3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C27H27N3O4/c1-32-20-11-9-19(10-12-20)29-26-17-22(21-6-4-5-7-23(21)30-26)27(31)28-15-14-18-8-13-24(33-2)25(16-18)34-3/h4-13,16-17H,14-15H2,1-3H3,(H,28,31)(H,29,30) |
| InChIKey | ZBNKKMVUPBTWGO-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |