C26H25N3O3 — CID 15990753
2-(3,4-dimethoxyanilino)-N-(2-phenylethyl)quinoline-4-carboxamide (PubChem CID 15990753) has the molecular formula C26H25N3O3 and a molecular weight of 427.50 g/mol. Its IUPAC name is 2-(3,4-dimethoxyanilino)-N-(2-phenylethyl)quinoline-4-carboxamide.
| Compound Name | 2-(3,4-dimethoxyanilino)-N-(2-phenylethyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 15990753 |
| Molecular Formula | C26H25N3O3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 2-(3,4-dimethoxyanilino)-N-(2-phenylethyl)quinoline-4-carboxamide |
| SMILES | COc1ccc(Nc2cc(C(=O)NCCc3ccccc3)c3ccccc3n2)cc1OC |
| InChI | InChI=1S/C26H25N3O3/c1-31-23-13-12-19(16-24(23)32-2)28-25-17-21(20-10-6-7-11-22(20)29-25)26(30)27-15-14-18-8-4-3-5-9-18/h3-13,16-17H,14-15H2,1-2H3,(H,27,30)(H,28,29) |
| InChIKey | OALCXHDDBKFVCQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |