C20H15ClN4O — CID 175093901
N-[(4-chlorophenyl)methyl]-2-imidazol-1-ylquinoline-4-carboxamide (PubChem CID 175093901) has the molecular formula C20H15ClN4O and a molecular weight of 362.82 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-imidazol-1-ylquinoline-4-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-imidazol-1-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 175093901 |
| Molecular Formula | C20H15ClN4O |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-imidazol-1-ylquinoline-4-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)c1cc(-n2ccnc2)nc2ccccc12 |
| InChI | InChI=1S/C20H15ClN4O/c21-15-7-5-14(6-8-15)12-23-20(26)17-11-19(25-10-9-22-13-25)24-18-4-2-1-3-16(17)18/h1-11,13H,12H2,(H,23,26) |
| InChIKey | ACBZLPNPXLMJLL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |