C26H31N3O — CID 20854533
N-cyclooctyl-2-(2,4-dimethylanilino)quinoline-4-carboxamide (PubChem CID 20854533) has the molecular formula C26H31N3O and a molecular weight of 401.55 g/mol. Its IUPAC name is N-cyclooctyl-2-(2,4-dimethylanilino)quinoline-4-carboxamide.
| Compound Name | N-cyclooctyl-2-(2,4-dimethylanilino)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 20854533 |
| Molecular Formula | C26H31N3O |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | N-cyclooctyl-2-(2,4-dimethylanilino)quinoline-4-carboxamide |
| SMILES | Cc1ccc(Nc2cc(C(=O)NC3CCCCCCC3)c3ccccc3n2)c(C)c1 |
| InChI | InChI=1S/C26H31N3O/c1-18-14-15-23(19(2)16-18)28-25-17-22(21-12-8-9-13-24(21)29-25)26(30)27-20-10-6-4-3-5-7-11-20/h8-9,12-17,20H,3-7,10-11H2,1-2H3,(H,27,30)(H,28,29) |
| InChIKey | KBGWHCSEZNHJAH-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |