C20H25N3O — CID 1441232
N-cyclohexyl-6-(2,4-dimethylanilino)pyridine-3-carboxamide (PubChem CID 1441232) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is N-cyclohexyl-6-(2,4-dimethylanilino)pyridine-3-carboxamide.
| Compound Name | N-cyclohexyl-6-(2,4-dimethylanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 1441232 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | N-cyclohexyl-6-(2,4-dimethylanilino)pyridine-3-carboxamide |
| SMILES | Cc1ccc(Nc2ccc(C(=O)NC3CCCCC3)cn2)c(C)c1 |
| InChI | InChI=1S/C20H25N3O/c1-14-8-10-18(15(2)12-14)23-19-11-9-16(13-21-19)20(24)22-17-6-4-3-5-7-17/h8-13,17H,3-7H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | ASKYSPFHXQNOSV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |