C22H27N3O2 — CID 17180897
N-cyclohexyl-4-[(2,4-dimethylphenyl)carbamoylamino]benzamide (PubChem CID 17180897) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is N-cyclohexyl-4-[(2,4-dimethylphenyl)carbamoylamino]benzamide.
| Compound Name | N-cyclohexyl-4-[(2,4-dimethylphenyl)carbamoylamino]benzamide |
|---|---|
| PubChem CID | 17180897 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | N-cyclohexyl-4-[(2,4-dimethylphenyl)carbamoylamino]benzamide |
| SMILES | Cc1ccc(NC(=O)Nc2ccc(C(=O)NC3CCCCC3)cc2)c(C)c1 |
| InChI | InChI=1S/C22H27N3O2/c1-15-8-13-20(16(2)14-15)25-22(27)24-19-11-9-17(10-12-19)21(26)23-18-6-4-3-5-7-18/h8-14,18H,3-7H2,1-2H3,(H,23,26)(H2,24,25,27) |
| InChIKey | WKBHQPUOPISMPF-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |