C21H23IN2O2 — CID 28587698
N-[4-(cyclohexylcarbamoyl)phenyl]-3-iodo-4-methylbenzamide (PubChem CID 28587698) has the molecular formula C21H23IN2O2 and a molecular weight of 462.33 g/mol. Its IUPAC name is N-[4-(cyclohexylcarbamoyl)phenyl]-3-iodo-4-methylbenzamide.
| Compound Name | N-[4-(cyclohexylcarbamoyl)phenyl]-3-iodo-4-methylbenzamide |
|---|---|
| PubChem CID | 28587698 |
| Molecular Formula | C21H23IN2O2 |
| Molecular Weight | 462.33 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | N-[4-(cyclohexylcarbamoyl)phenyl]-3-iodo-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(C(=O)NC3CCCCC3)cc2)cc1I |
| InChI | InChI=1S/C21H23IN2O2/c1-14-7-8-16(13-19(14)22)21(26)24-18-11-9-15(10-12-18)20(25)23-17-5-3-2-4-6-17/h7-13,17H,2-6H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | UQXLCYFLSWVTQD-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.33 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|