C23H26N2O4 — CID 109056131
methyl 4-[[3-(cycloheptylcarbamoyl)benzoyl]amino]benzoate (PubChem CID 109056131) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is methyl 4-[[3-(cycloheptylcarbamoyl)benzoyl]amino]benzoate.
| Compound Name | methyl 4-[[3-(cycloheptylcarbamoyl)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 109056131 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | methyl 4-[[3-(cycloheptylcarbamoyl)benzoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2cccc(C(=O)NC3CCCCCC3)c2)cc1 |
| InChI | InChI=1S/C23H26N2O4/c1-29-23(28)16-11-13-20(14-12-16)25-22(27)18-8-6-7-17(15-18)21(26)24-19-9-4-2-3-5-10-19/h6-8,11-15,19H,2-5,9-10H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | HCRKJAICSJQDBI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |