C21H23N3O4 — CID 109095382
methyl 4-[[6-(cyclohexylcarbamoyl)pyridine-2-carbonyl]amino]benzoate (PubChem CID 109095382) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is methyl 4-[[6-(cyclohexylcarbamoyl)pyridine-2-carbonyl]amino]benzoate.
| Compound Name | methyl 4-[[6-(cyclohexylcarbamoyl)pyridine-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109095382 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | methyl 4-[[6-(cyclohexylcarbamoyl)pyridine-2-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2cccc(C(=O)NC3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C21H23N3O4/c1-28-21(27)14-10-12-16(13-11-14)23-20(26)18-9-5-8-17(24-18)19(25)22-15-6-3-2-4-7-15/h5,8-13,15H,2-4,6-7H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | NFDUGJLHHSMWDF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |