C23H27NO2 — CID 793898
N-cyclohexyl-4-(2,4,6-trimethylbenzoyl)benzamide (PubChem CID 793898) has the molecular formula C23H27NO2 and a molecular weight of 349.47 g/mol. Its IUPAC name is N-cyclohexyl-4-(2,4,6-trimethylbenzoyl)benzamide.
| Compound Name | N-cyclohexyl-4-(2,4,6-trimethylbenzoyl)benzamide |
|---|---|
| PubChem CID | 793898 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | N-cyclohexyl-4-(2,4,6-trimethylbenzoyl)benzamide |
| SMILES | Cc1cc(C)c(C(=O)c2ccc(C(=O)NC3CCCCC3)cc2)c(C)c1 |
| InChI | InChI=1S/C23H27NO2/c1-15-13-16(2)21(17(3)14-15)22(25)18-9-11-19(12-10-18)23(26)24-20-7-5-4-6-8-20/h9-14,20H,4-8H2,1-3H3,(H,24,26) |
| InChIKey | GAWQHFUSYUKMLU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |