C15H23NO — CID 142916267
N-cyclobutyl-3,4-dimethylbenzamide;ethane (PubChem CID 142916267) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is N-cyclobutyl-3,4-dimethylbenzamide;ethane.
| Compound Name | N-cyclobutyl-3,4-dimethylbenzamide;ethane |
|---|---|
| PubChem CID | 142916267 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | N-cyclobutyl-3,4-dimethylbenzamide;ethane |
| SMILES | CC.Cc1ccc(C(=O)NC2CCC2)cc1C |
| InChI | InChI=1S/C13H17NO.C2H6/c1-9-6-7-11(8-10(9)2)13(15)14-12-4-3-5-12;1-2/h6-8,12H,3-5H2,1-2H3,(H,14,15);1-2H3 |
| InChIKey | PPOCMNBPFNJMGP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |