C18H23NO — CID 171081015
N-cyclohexyl-5-methylcyclodeca-1,3,5,7,9-pentaene-1-carboxamide (PubChem CID 171081015) has the molecular formula C18H23NO and a molecular weight of 269.39 g/mol. Its IUPAC name is N-cyclohexyl-5-methylcyclodeca-1,3,5,7,9-pentaene-1-carboxamide.
| Compound Name | N-cyclohexyl-5-methylcyclodeca-1,3,5,7,9-pentaene-1-carboxamide |
|---|---|
| PubChem CID | 171081015 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | N-cyclohexyl-5-methylcyclodeca-1,3,5,7,9-pentaene-1-carboxamide |
| SMILES | Cc1cccccc(C(=O)NC2CCCCC2)ccc1 |
| InChI | InChI=1S/C18H23NO/c1-15-9-4-2-5-11-16(12-8-10-15)18(20)19-17-13-6-3-7-14-17/h2,4-5,8-12,17H,3,6-7,13-14H2,1H3,(H,19,20)/b4-2-,5-2+,9-4-,10-8+,11-5+,12-8-,15-9-,15-10+,16-11+,16-12+ |
| InChIKey | MXXKGMHAKXTLTI-YPCJYMLLSA-N |
| XLogP | 4.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |