C21H31NO — CID 166761299
N-(4-cyclohexylcyclooctyl)benzamide (PubChem CID 166761299) has the molecular formula C21H31NO and a molecular weight of 313.48 g/mol. Its IUPAC name is N-(4-cyclohexylcyclooctyl)benzamide.
| Compound Name | N-(4-cyclohexylcyclooctyl)benzamide |
|---|---|
| PubChem CID | 166761299 |
| Molecular Formula | C21H31NO |
| Molecular Weight | 313.48 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | N-(4-cyclohexylcyclooctyl)benzamide |
| SMILES | O=C(NC1CCCCC(C2CCCCC2)CC1)c1ccccc1 |
| InChI | InChI=1S/C21H31NO/c23-21(19-12-5-2-6-13-19)22-20-14-8-7-11-18(15-16-20)17-9-3-1-4-10-17/h2,5-6,12-13,17-18,20H,1,3-4,7-11,14-16H2,(H,22,23) |
| InChIKey | LVIHCTIYNJNGMJ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.48 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |