C12H14FNO — CID 129348896
N-[(1R,3R)-3-fluorocyclopentyl]benzamide (PubChem CID 129348896) has the molecular formula C12H14FNO and a molecular weight of 207.25 g/mol. Its IUPAC name is N-[(1R,3R)-3-fluorocyclopentyl]benzamide.
| Compound Name | N-[(1R,3R)-3-fluorocyclopentyl]benzamide |
|---|---|
| PubChem CID | 129348896 |
| Molecular Formula | C12H14FNO |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | N-[(1R,3R)-3-fluorocyclopentyl]benzamide |
| SMILES | O=C(N[C@@H]1CC[C@@H](F)C1)c1ccccc1 |
| InChI | InChI=1S/C12H14FNO/c13-10-6-7-11(8-10)14-12(15)9-4-2-1-3-5-9/h1-5,10-11H,6-8H2,(H,14,15)/t10-,11-/m1/s1 |
| InChIKey | NSLWDKZVFDXDEY-GHMZBOCLSA-N |
| XLogP | 2.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |