C23H27NO — CID 175179674
N-[(2S)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-4-phenylbenzamide (PubChem CID 175179674) has the molecular formula C23H27NO and a molecular weight of 333.48 g/mol. Its IUPAC name is N-[(2S)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-4-phenylbenzamide.
| Compound Name | N-[(2S)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 175179674 |
| Molecular Formula | C23H27NO |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | N-[(2S)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-4-phenylbenzamide |
| SMILES | O=C(N[C@H]1CCC2CCCCC2C1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H27NO/c25-23(24-22-15-14-18-8-4-5-9-21(18)16-22)20-12-10-19(11-13-20)17-6-2-1-3-7-17/h1-3,6-7,10-13,18,21-22H,4-5,8-9,14-16H2,(H,24,25)/t18?,21?,22-/m0/s1 |
| InChIKey | MLKQNROEJKQGBI-UDJZJCJKSA-N |
| XLogP | 5.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |