C19H24N4O — CID 124743149
N-[(2R,4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 124743149) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is N-[(2R,4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-[(2R,4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 124743149 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | N-[(2R,4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | O=C(N[C@@H]1CC[C@@H]2CCCC[C@H]2C1)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C19H24N4O/c24-19(15-6-9-18(10-7-15)23-13-20-12-21-23)22-17-8-5-14-3-1-2-4-16(14)11-17/h6-7,9-10,12-14,16-17H,1-5,8,11H2,(H,22,24)/t14-,16-,17+/m0/s1 |
| InChIKey | YPXPEICKLFUDGD-BHYGNILZSA-N |
| XLogP | 3.36 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |