C21H28N4O2 — CID 50979481
N-[(2R,4R,6S)-2-cyclohexyl-6-[4-(1,2,4-triazol-1-yl)phenyl]oxan-4-yl]acetamide (PubChem CID 50979481) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is N-[(2R,4R,6S)-2-cyclohexyl-6-[4-(1,2,4-triazol-1-yl)phenyl]oxan-4-yl]acetamide.
| Compound Name | N-[(2R,4R,6S)-2-cyclohexyl-6-[4-(1,2,4-triazol-1-yl)phenyl]oxan-4-yl]acetamide |
|---|---|
| PubChem CID | 50979481 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | N-[(2R,4R,6S)-2-cyclohexyl-6-[4-(1,2,4-triazol-1-yl)phenyl]oxan-4-yl]acetamide |
| SMILES | CC(=O)N[C@H]1C[C@@H](c2ccc(-n3cncn3)cc2)O[C@@H](C2CCCCC2)C1 |
| InChI | InChI=1S/C21H28N4O2/c1-15(26)24-18-11-20(16-5-3-2-4-6-16)27-21(12-18)17-7-9-19(10-8-17)25-14-22-13-23-25/h7-10,13-14,16,18,20-21H,2-6,11-12H2,1H3,(H,24,26)/t18-,20-,21+/m1/s1 |
| InChIKey | LCKUVCVAPIWLJS-NRSPTQNISA-N |
| XLogP | 3.57 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |