C20H32N4O2 — CID 50972806
N-[(2R,4R,6S)-2-cyclohexyl-6-[2-(propylamino)pyrimidin-5-yl]oxan-4-yl]acetamide (PubChem CID 50972806) has the molecular formula C20H32N4O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is N-[(2R,4R,6S)-2-cyclohexyl-6-[2-(propylamino)pyrimidin-5-yl]oxan-4-yl]acetamide.
| Compound Name | N-[(2R,4R,6S)-2-cyclohexyl-6-[2-(propylamino)pyrimidin-5-yl]oxan-4-yl]acetamide |
|---|---|
| PubChem CID | 50972806 |
| Molecular Formula | C20H32N4O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | N-[(2R,4R,6S)-2-cyclohexyl-6-[2-(propylamino)pyrimidin-5-yl]oxan-4-yl]acetamide |
| SMILES | CCCNc1ncc([C@@H]2C[C@H](NC(C)=O)C[C@H](C3CCCCC3)O2)cn1 |
| InChI | InChI=1S/C20H32N4O2/c1-3-9-21-20-22-12-16(13-23-20)19-11-17(24-14(2)25)10-18(26-19)15-7-5-4-6-8-15/h12-13,15,17-19H,3-11H2,1-2H3,(H,24,25)(H,21,22,23)/t17-,18-,19+/m1/s1 |
| InChIKey | ZUZCEFNXXBSRKV-QRVBRYPASA-N |
| XLogP | 3.60 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |