C21H27N3O2 — CID 50958809
N-[(2R,4R,6S)-2-cyclohexyl-6-quinoxalin-2-yloxan-4-yl]acetamide (PubChem CID 50958809) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is N-[(2R,4R,6S)-2-cyclohexyl-6-quinoxalin-2-yloxan-4-yl]acetamide.
| Compound Name | N-[(2R,4R,6S)-2-cyclohexyl-6-quinoxalin-2-yloxan-4-yl]acetamide |
|---|---|
| PubChem CID | 50958809 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | N-[(2R,4R,6S)-2-cyclohexyl-6-quinoxalin-2-yloxan-4-yl]acetamide |
| SMILES | CC(=O)N[C@H]1C[C@@H](c2cnc3ccccc3n2)O[C@@H](C2CCCCC2)C1 |
| InChI | InChI=1S/C21H27N3O2/c1-14(25)23-16-11-20(15-7-3-2-4-8-15)26-21(12-16)19-13-22-17-9-5-6-10-18(17)24-19/h5-6,9-10,13,15-16,20-21H,2-4,7-8,11-12H2,1H3,(H,23,25)/t16-,20-,21+/m1/s1 |
| InChIKey | QYDODFFXQKNOKC-HBGVWJBISA-N |
| XLogP | 3.93 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |