C14H19NO — CID 102139469
N-[(1R,3R)-3-phenylcyclohexyl]acetamide (PubChem CID 102139469) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is N-[(1R,3R)-3-phenylcyclohexyl]acetamide.
| Compound Name | N-[(1R,3R)-3-phenylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 102139469 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | N-[(1R,3R)-3-phenylcyclohexyl]acetamide |
| SMILES | CC(=O)N[C@@H]1CCC[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C14H19NO/c1-11(16)15-14-9-5-8-13(10-14)12-6-3-2-4-7-12/h2-4,6-7,13-14H,5,8-10H2,1H3,(H,15,16)/t13-,14-/m1/s1 |
| InChIKey | NGJGRZHJAQFLFC-ZIAGYGMSSA-N |
| XLogP | 2.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |