C9H17NO — CID 143244343
N-[(3S)-3-methylcyclohexyl]acetamide (PubChem CID 143244343) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is N-[(3S)-3-methylcyclohexyl]acetamide.
| Compound Name | N-[(3S)-3-methylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 143244343 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | N-[(3S)-3-methylcyclohexyl]acetamide |
| SMILES | CC(=O)NC1CCC[C@H](C)C1 |
| InChI | InChI=1S/C9H17NO/c1-7-4-3-5-9(6-7)10-8(2)11/h7,9H,3-6H2,1-2H3,(H,10,11)/t7-,9?/m0/s1 |
| InChIKey | SHLOFFKQHDQUNH-JAVCKPHESA-N |
| XLogP | 1.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |