C18H29NO — CID 94043121
N-[(1R,3R)-3-methylcyclohexyl]adamantane-1-carboxamide (PubChem CID 94043121) has the molecular formula C18H29NO and a molecular weight of 275.44 g/mol. Its IUPAC name is N-[(1R,3R)-3-methylcyclohexyl]adamantane-1-carboxamide.
| Compound Name | N-[(1R,3R)-3-methylcyclohexyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 94043121 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | N-[(1R,3R)-3-methylcyclohexyl]adamantane-1-carboxamide |
| SMILES | C[C@@H]1CCC[C@@H](NC(=O)C23CC4CC(CC(C4)C2)C3)C1 |
| InChI | InChI=1S/C18H29NO/c1-12-3-2-4-16(5-12)19-17(20)18-9-13-6-14(10-18)8-15(7-13)11-18/h12-16H,2-11H2,1H3,(H,19,20)/t12-,13?,14?,15?,16-,18?/m1/s1 |
| InChIKey | IGGVVPUTYUSMEG-CDJLDAARSA-N |
| XLogP | 3.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |