C25H34N2O — CID 19935050
1-[2,6-di(propan-2-yl)phenyl]-3-(3-phenylcyclohexyl)urea (PubChem CID 19935050) has the molecular formula C25H34N2O and a molecular weight of 378.56 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-(3-phenylcyclohexyl)urea.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-(3-phenylcyclohexyl)urea |
|---|---|
| PubChem CID | 19935050 |
| Molecular Formula | C25H34N2O |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-(3-phenylcyclohexyl)urea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)NC1CCCC(c2ccccc2)C1 |
| InChI | InChI=1S/C25H34N2O/c1-17(2)22-14-9-15-23(18(3)4)24(22)27-25(28)26-21-13-8-12-20(16-21)19-10-6-5-7-11-19/h5-7,9-11,14-15,17-18,20-21H,8,12-13,16H2,1-4H3,(H2,26,27,28) |
| InChIKey | SHOBKVZNJKGWEZ-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |