C26H36N2OS — CID 68631998
1-[cyclohexyl(phenylsulfanyl)methyl]-3-[2,6-di(propan-2-yl)phenyl]urea (PubChem CID 68631998) has the molecular formula C26H36N2OS and a molecular weight of 424.65 g/mol. Its IUPAC name is 1-[cyclohexyl(phenylsulfanyl)methyl]-3-[2,6-di(propan-2-yl)phenyl]urea.
| Compound Name | 1-[cyclohexyl(phenylsulfanyl)methyl]-3-[2,6-di(propan-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 68631998 |
| Molecular Formula | C26H36N2OS |
| Molecular Weight | 424.65 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | 1-[cyclohexyl(phenylsulfanyl)methyl]-3-[2,6-di(propan-2-yl)phenyl]urea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)NC(Sc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C26H36N2OS/c1-18(2)22-16-11-17-23(19(3)4)24(22)27-26(29)28-25(20-12-7-5-8-13-20)30-21-14-9-6-10-15-21/h6,9-11,14-20,25H,5,7-8,12-13H2,1-4H3,(H2,27,28,29) |
| InChIKey | INHWIMGBFJUEBT-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.65 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|