C25H40N2O — CID 19935038
1-(4-cyclohexylcyclohexyl)-3-[2,6-di(propan-2-yl)phenyl]urea (PubChem CID 19935038) has the molecular formula C25H40N2O and a molecular weight of 384.61 g/mol. Its IUPAC name is 1-(4-cyclohexylcyclohexyl)-3-[2,6-di(propan-2-yl)phenyl]urea.
| Compound Name | 1-(4-cyclohexylcyclohexyl)-3-[2,6-di(propan-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 19935038 |
| Molecular Formula | C25H40N2O |
| Molecular Weight | 384.61 g/mol |
| Exact Mass | 384.31 |
| IUPAC Name | 1-(4-cyclohexylcyclohexyl)-3-[2,6-di(propan-2-yl)phenyl]urea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)NC1CCC(C2CCCCC2)CC1 |
| InChI | InChI=1S/C25H40N2O/c1-17(2)22-11-8-12-23(18(3)4)24(22)27-25(28)26-21-15-13-20(14-16-21)19-9-6-5-7-10-19/h8,11-12,17-21H,5-7,9-10,13-16H2,1-4H3,(H2,26,27,28) |
| InChIKey | SYTTULXZYPDQOZ-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.61 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |