C27H38N2OS — CID 68632761
1-[cyclohexyl-(4-methylphenyl)sulfanylmethyl]-3-[2,6-di(propan-2-yl)phenyl]urea (PubChem CID 68632761) has the molecular formula C27H38N2OS and a molecular weight of 438.68 g/mol. Its IUPAC name is 1-[cyclohexyl-(4-methylphenyl)sulfanylmethyl]-3-[2,6-di(propan-2-yl)phenyl]urea.
| Compound Name | 1-[cyclohexyl-(4-methylphenyl)sulfanylmethyl]-3-[2,6-di(propan-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 68632761 |
| Molecular Formula | C27H38N2OS |
| Molecular Weight | 438.68 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | 1-[cyclohexyl-(4-methylphenyl)sulfanylmethyl]-3-[2,6-di(propan-2-yl)phenyl]urea |
| SMILES | Cc1ccc(SC(NC(=O)Nc2c(C(C)C)cccc2C(C)C)C2CCCCC2)cc1 |
| InChI | InChI=1S/C27H38N2OS/c1-18(2)23-12-9-13-24(19(3)4)25(23)28-27(30)29-26(21-10-7-6-8-11-21)31-22-16-14-20(5)15-17-22/h9,12-19,21,26H,6-8,10-11H2,1-5H3,(H2,28,29,30) |
| InChIKey | OFUNTWHKOCAVTC-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.68 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|