C39H46N2OS — CID 68631753
1-[cyclohexyl-(2-phenylphenyl)sulfanylmethyl]-3-[2,6-di(propan-2-yl)phenyl]-1-(4-methylphenyl)urea (PubChem CID 68631753) has the molecular formula C39H46N2OS and a molecular weight of 590.88 g/mol. Its IUPAC name is 1-[cyclohexyl-(2-phenylphenyl)sulfanylmethyl]-3-[2,6-di(propan-2-yl)phenyl]-1-(4-methylphenyl)urea.
| Compound Name | 1-[cyclohexyl-(2-phenylphenyl)sulfanylmethyl]-3-[2,6-di(propan-2-yl)phenyl]-1-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 68631753 |
| Molecular Formula | C39H46N2OS |
| Molecular Weight | 590.88 g/mol |
| Exact Mass | 590.33 |
| IUPAC Name | 1-[cyclohexyl-(2-phenylphenyl)sulfanylmethyl]-3-[2,6-di(propan-2-yl)phenyl]-1-(4-methylphenyl)urea |
| SMILES | Cc1ccc(N(C(=O)Nc2c(C(C)C)cccc2C(C)C)C(Sc2ccccc2-c2ccccc2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C39H46N2OS/c1-27(2)33-20-14-21-34(28(3)4)37(33)40-39(42)41(32-25-23-29(5)24-26-32)38(31-17-10-7-11-18-31)43-36-22-13-12-19-35(36)30-15-8-6-9-16-30/h6,8-9,12-16,19-28,31,38H,7,10-11,17-18H2,1-5H3,(H,40,42) |
| InChIKey | MSNQBUCTCIBATR-UHFFFAOYSA-N |
| XLogP | 11.65 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.88 |
| LogP ≤ 5 | 11.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|