C19H24INO — CID 175991462
N-[2,6-di(propan-2-yl)phenyl]benzamide;hydroiodide (PubChem CID 175991462) has the molecular formula C19H24INO and a molecular weight of 409.31 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]benzamide;hydroiodide.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 175991462 |
| Molecular Formula | C19H24INO |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]benzamide;hydroiodide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)c1ccccc1.I |
| InChI | InChI=1S/C19H23NO.HI/c1-13(2)16-11-8-12-17(14(3)4)18(16)20-19(21)15-9-6-5-7-10-15;/h5-14H,1-4H3,(H,20,21);1H |
| InChIKey | QHMLIGWETWNPSU-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|