C26H28N2O — CID 136845607
N-[N-[2,6-di(propan-2-yl)phenyl]-C-phenylcarbonimidoyl]benzamide (PubChem CID 136845607) has the molecular formula C26H28N2O and a molecular weight of 384.52 g/mol. Its IUPAC name is N-[N-[2,6-di(propan-2-yl)phenyl]-C-phenylcarbonimidoyl]benzamide.
| Compound Name | N-[N-[2,6-di(propan-2-yl)phenyl]-C-phenylcarbonimidoyl]benzamide |
|---|---|
| PubChem CID | 136845607 |
| Molecular Formula | C26H28N2O |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | N-[N-[2,6-di(propan-2-yl)phenyl]-C-phenylcarbonimidoyl]benzamide |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C(\NC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H28N2O/c1-18(2)22-16-11-17-23(19(3)4)24(22)27-25(20-12-7-5-8-13-20)28-26(29)21-14-9-6-10-15-21/h5-19H,1-4H3,(H,27,28,29) |
| InChIKey | HKOPOZNIBLCONZ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|