C19H22ClN — CID 22596623
N-[2,6-di(propan-2-yl)phenyl]benzenecarboximidoyl chloride (PubChem CID 22596623) has the molecular formula C19H22ClN and a molecular weight of 299.84 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]benzenecarboximidoyl chloride.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]benzenecarboximidoyl chloride |
|---|---|
| PubChem CID | 22596623 |
| Molecular Formula | C19H22ClN |
| Molecular Weight | 299.84 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]benzenecarboximidoyl chloride |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C(\Cl)c1ccccc1 |
| InChI | InChI=1S/C19H22ClN/c1-13(2)16-11-8-12-17(14(3)4)18(16)21-19(20)15-9-6-5-7-10-15/h5-14H,1-4H3/b21-19- |
| InChIKey | FQRZDSKPENEPJC-VZCXRCSSSA-N |
| XLogP | 6.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.84 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|