C27H28Br2N2 — CID 90084912
1-N-(2,6-dibromophenyl)-2-N-[2,6-di(propan-2-yl)phenyl]-1-phenylpropane-1,2-diimine (PubChem CID 90084912) has the molecular formula C27H28Br2N2 and a molecular weight of 540.34 g/mol. Its IUPAC name is 1-N-(2,6-dibromophenyl)-2-N-[2,6-di(propan-2-yl)phenyl]-1-phenylpropane-1,2-diimine.
| Compound Name | 1-N-(2,6-dibromophenyl)-2-N-[2,6-di(propan-2-yl)phenyl]-1-phenylpropane-1,2-diimine |
|---|---|
| PubChem CID | 90084912 |
| Molecular Formula | C27H28Br2N2 |
| Molecular Weight | 540.34 g/mol |
| Exact Mass | 538.06 |
| IUPAC Name | 1-N-(2,6-dibromophenyl)-2-N-[2,6-di(propan-2-yl)phenyl]-1-phenylpropane-1,2-diimine |
| SMILES | CC(=N\c1c(C(C)C)cccc1C(C)C)/C(=N/c1c(Br)cccc1Br)c1ccccc1 |
| InChI | InChI=1S/C27H28Br2N2/c1-17(2)21-13-9-14-22(18(3)4)26(21)30-19(5)25(20-11-7-6-8-12-20)31-27-23(28)15-10-16-24(27)29/h6-18H,1-5H3/b30-19+,31-25- |
| InChIKey | UOEYTDHFUVDUCK-ZWGJVRDHSA-N |
| XLogP | 9.37 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.34 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|