C37H50N2Ni — CID 139167024
2-N,3-N-bis[2,6-di(propan-2-yl)phenyl]butane-2,3-diimine;nickel;[(E)-prop-1-enyl]benzene (PubChem CID 139167024) has the molecular formula C37H50N2Ni and a molecular weight of 581.51 g/mol. Its IUPAC name is 2-N,3-N-bis[2,6-di(propan-2-yl)phenyl]butane-2,3-diimine;nickel;[(E)-prop-1-enyl]benzene.
| Compound Name | 2-N,3-N-bis[2,6-di(propan-2-yl)phenyl]butane-2,3-diimine;nickel;[(E)-prop-1-enyl]benzene |
|---|---|
| PubChem CID | 139167024 |
| Molecular Formula | C37H50N2Ni |
| Molecular Weight | 581.51 g/mol |
| Exact Mass | 580.33 |
| IUPAC Name | 2-N,3-N-bis[2,6-di(propan-2-yl)phenyl]butane-2,3-diimine;nickel;[(E)-prop-1-enyl]benzene |
| SMILES | C/C=C\c1ccccc1.CC(=N\c1c(C(C)C)cccc1C(C)C)/C(C)=N/c1c(C(C)C)cccc1C(C)C.[Ni] |
| InChI | InChI=1S/C28H40N2.C9H10.Ni/c1-17(2)23-13-11-14-24(18(3)4)27(23)29-21(9)22(10)30-28-25(19(5)6)15-12-16-26(28)20(7)8;1-2-6-9-7-4-3-5-8-9;/h11-20H,1-10H3;2-8H,1H3;/b29-21+,30-22+;6-2-; |
| InChIKey | XMNTYFCTUPNNEE-VSTUHLPHSA-N |
| XLogP | 11.78 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.51 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|