C42H58Br4N4Pd2 — CID 20750698
bis(dibromopalladium);3-N-[2,6-di(propan-2-yl)phenyl]-2-N-[4-[3-[2,6-di(propan-2-yl)phenyl]iminobutan-2-ylideneamino]-2,3,5,6-tetramethylphenyl]butane-2,3-diimine (PubChem CID 20750698) has the molecular formula C42H58Br4N4Pd2 and a molecular weight of 1151.41 g/mol. Its IUPAC name is bis(dibromopalladium);3-N-[2,6-di(propan-2-yl)phenyl]-2-N-[4-[3-[2,6-di(propan-2-yl)phenyl]iminobutan-2-ylideneamino]-2,3,5,6-tetramethylphenyl]butane-2,3-diimine.
| Compound Name | bis(dibromopalladium);3-N-[2,6-di(propan-2-yl)phenyl]-2-N-[4-[3-[2,6-di(propan-2-yl)phenyl]iminobutan-2-ylideneamino]-2,3,5,6-tetramethylphenyl]butane-2,3-diimine |
|---|---|
| PubChem CID | 20750698 |
| Molecular Formula | C42H58Br4N4Pd2 |
| Molecular Weight | 1151.41 g/mol |
| Exact Mass | 1145.95 |
| IUPAC Name | bis(dibromopalladium);3-N-[2,6-di(propan-2-yl)phenyl]-2-N-[4-[3-[2,6-di(propan-2-yl)phenyl]iminobutan-2-ylideneamino]-2,3,5,6-tetramethylphenyl]butane-2,3-diimine |
| SMILES | Br[Pd]Br.Br[Pd]Br.CC(=N\c1c(C(C)C)cccc1C(C)C)/C(C)=N/c1c(C)c(C)c(/N=C(C)/C(C)=N/c2c(C(C)C)cccc2C(C)C)c(C)c1C |
| InChI | InChI=1S/C42H58N4.4BrH.2Pd/c1-23(2)35-19-17-20-36(24(3)4)41(35)45-33(15)31(13)43-39-27(9)29(11)40(30(12)28(39)10)44-32(14)34(16)46-42-37(25(5)6)21-18-22-38(42)26(7)8;;;;;;/h17-26H,1-16H3;4*1H;;/q;;;;;2*+2/p-4/b43-31+,44-32+,45-33+,46-34+;;;;;; |
| InChIKey | YNLFGMVJIUPIQW-PRKOADPOSA-J |
| XLogP | 16.56 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1151.41 |
| LogP ≤ 5 | 16.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|