C13H19N — CID 123174070
N-(2-methyl-6-propan-2-ylphenyl)propan-2-imine (PubChem CID 123174070) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is N-(2-methyl-6-propan-2-ylphenyl)propan-2-imine.
| Compound Name | N-(2-methyl-6-propan-2-ylphenyl)propan-2-imine |
|---|---|
| PubChem CID | 123174070 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | N-(2-methyl-6-propan-2-ylphenyl)propan-2-imine |
| SMILES | CC(C)=Nc1c(C)cccc1C(C)C |
| InChI | InChI=1S/C13H19N/c1-9(2)12-8-6-7-11(5)13(12)14-10(3)4/h6-9H,1-5H3 |
| InChIKey | HXYFBWMATZYKBH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|