C16H25NO — CID 139084602
ethyl N-[2,6-di(propan-2-yl)phenyl]ethanimidate (PubChem CID 139084602) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is ethyl N-[2,6-di(propan-2-yl)phenyl]ethanimidate.
| Compound Name | ethyl N-[2,6-di(propan-2-yl)phenyl]ethanimidate |
|---|---|
| PubChem CID | 139084602 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | ethyl N-[2,6-di(propan-2-yl)phenyl]ethanimidate |
| SMILES | CCO/C(C)=N/c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C16H25NO/c1-7-18-13(6)17-16-14(11(2)3)9-8-10-15(16)12(4)5/h8-12H,7H2,1-6H3/b17-13+ |
| InChIKey | FYMVBWHCDKHEBT-GHRIWEEISA-N |
| XLogP | 5.02 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|