C21H33NO — CID 139343054
6-[2,6-di(propan-2-yl)phenyl]imino-4-ethylheptan-2-one (PubChem CID 139343054) has the molecular formula C21H33NO and a molecular weight of 315.50 g/mol. Its IUPAC name is 6-[2,6-di(propan-2-yl)phenyl]imino-4-ethylheptan-2-one.
| Compound Name | 6-[2,6-di(propan-2-yl)phenyl]imino-4-ethylheptan-2-one |
|---|---|
| PubChem CID | 139343054 |
| Molecular Formula | C21H33NO |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.26 |
| IUPAC Name | 6-[2,6-di(propan-2-yl)phenyl]imino-4-ethylheptan-2-one |
| SMILES | CCC(CC(C)=O)C/C(C)=N/c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C21H33NO/c1-8-18(13-17(7)23)12-16(6)22-21-19(14(2)3)10-9-11-20(21)15(4)5/h9-11,14-15,18H,8,12-13H2,1-7H3/b22-16+ |
| InChIKey | CYGAFHSHJGIJCE-CJLVFECKSA-N |
| XLogP | 6.42 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|