C32H48N2 — CID 126613596
3-N,5-N-bis[2,6-di(propan-2-yl)phenyl]-4-methylheptane-3,5-diimine (PubChem CID 126613596) has the molecular formula C32H48N2 and a molecular weight of 460.75 g/mol. Its IUPAC name is 3-N,5-N-bis[2,6-di(propan-2-yl)phenyl]-4-methylheptane-3,5-diimine.
| Compound Name | 3-N,5-N-bis[2,6-di(propan-2-yl)phenyl]-4-methylheptane-3,5-diimine |
|---|---|
| PubChem CID | 126613596 |
| Molecular Formula | C32H48N2 |
| Molecular Weight | 460.75 g/mol |
| Exact Mass | 460.38 |
| IUPAC Name | 3-N,5-N-bis[2,6-di(propan-2-yl)phenyl]-4-methylheptane-3,5-diimine |
| SMILES | CC/C(=N\c1c(C(C)C)cccc1C(C)C)C(C)/C(CC)=N/c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C32H48N2/c1-12-29(33-31-25(20(3)4)16-14-17-26(31)21(5)6)24(11)30(13-2)34-32-27(22(7)8)18-15-19-28(32)23(9)10/h14-24H,12-13H2,1-11H3/b33-29+,34-30+ |
| InChIKey | WQGMMHNFJSMRBR-BNRZXNFUSA-N |
| XLogP | 10.48 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.75 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|