C25H37N2ORe- — CID 177456396
bis[[2,6-di(propan-2-yl)phenyl]imino]-oxorhenium;carbanide (PubChem CID 177456396) has the molecular formula C25H37N2ORe- and a molecular weight of 567.79 g/mol. Its IUPAC name is bis[[2,6-di(propan-2-yl)phenyl]imino]-oxorhenium;carbanide.
| Compound Name | bis[[2,6-di(propan-2-yl)phenyl]imino]-oxorhenium;carbanide |
|---|---|
| PubChem CID | 177456396 |
| Molecular Formula | C25H37N2ORe- |
| Molecular Weight | 567.79 g/mol |
| Exact Mass | 568.25 |
| IUPAC Name | bis[[2,6-di(propan-2-yl)phenyl]imino]-oxorhenium;carbanide |
| SMILES | CC(C)c1cccc(C(C)C)c1N=[Re](=O)=Nc1c(C(C)C)cccc1C(C)C.[CH3-] |
| InChI | InChI=1S/2C12H17N.CH3.O.Re/c2*1-8(2)10-6-5-7-11(9(3)4)12(10)13;;;/h2*5-9H,1-4H3;1H3;;/q;;-1;; |
| InChIKey | DOTYEUBGKTZHAH-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.79 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|