C31H43N4Re-3 — CID 12055999
(2-azanidylphenyl)azanide;bis[[2,6-di(propan-2-yl)phenyl]imino]rhenium;carbanide (PubChem CID 12055999) has the molecular formula C31H43N4Re-3 and a molecular weight of 657.92 g/mol. Its IUPAC name is (2-azanidylphenyl)azanide;bis[[2,6-di(propan-2-yl)phenyl]imino]rhenium;carbanide.
| Compound Name | (2-azanidylphenyl)azanide;bis[[2,6-di(propan-2-yl)phenyl]imino]rhenium;carbanide |
|---|---|
| PubChem CID | 12055999 |
| Molecular Formula | C31H43N4Re-3 |
| Molecular Weight | 657.92 g/mol |
| Exact Mass | 658.31 |
| IUPAC Name | (2-azanidylphenyl)azanide;bis[[2,6-di(propan-2-yl)phenyl]imino]rhenium;carbanide |
| SMILES | CC(C)c1cccc(C(C)C)c1N=[Re]=Nc1c(C(C)C)cccc1C(C)C.[CH3-].[NH-]c1ccccc1[NH-] |
| InChI | InChI=1S/2C12H17N.C6H6N2.CH3.Re/c2*1-8(2)10-6-5-7-11(9(3)4)12(10)13;7-5-3-1-2-4-6(5)8;;/h2*5-9H,1-4H3;1-4,7-8H;1H3;/q;;-2;-1; |
| InChIKey | KUOBTUVYJQMZKI-UHFFFAOYSA-N |
| XLogP | 12.10 |
| TPSA | 72.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.92 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|