About lithium;hydride;2-propan-2-ylphenol
lithium;hydride;2-propan-2-ylphenol (PubChem CID 175276368) has the molecular formula C9H13LiO
and a molecular weight of 144.14 g/mol. Its IUPAC name is lithium;hydride;2-propan-2-ylphenol.
Molecular Properties
| Compound Name | lithium;hydride;2-propan-2-ylphenol |
| PubChem CID | 175276368 |
| Molecular Formula | C9H13LiO |
| Molecular Weight | 144.14 g/mol |
| Exact Mass | 144.11 |
| IUPAC Name | lithium;hydride;2-propan-2-ylphenol |
| SMILES | CC(C)c1ccccc1O.[H-].[Li+] |
| InChI | InChI=1S/C9H12O.Li.H/c1-7(2)8-5-3-4-6-9(8)10;;/h3-7,10H,1-2H3;;/q;+1;-1 |
| InChIKey | UDGJDVMLRNUFLO-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.14 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze lithium;hydride;2-propan-2-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydride;2-propan-2-ylphenol?
The IUPAC name of lithium;hydride;2-propan-2-ylphenol (CID 175276368) is lithium;hydride;2-propan-2-ylphenol.
What is the SMILES notation for lithium;hydride;2-propan-2-ylphenol?
The canonical SMILES for lithium;hydride;2-propan-2-ylphenol is CC(C)c1ccccc1O.[H-].[Li+].
What is the InChIKey of lithium;hydride;2-propan-2-ylphenol?
The InChIKey is UDGJDVMLRNUFLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O.Li.H/c1-7(2)8-5-3-4-6-9(8)10;;/h3-7,10H,1-2H3;;/q;+1;-1.
What are the key properties of lithium;hydride;2-propan-2-ylphenol?
lithium;hydride;2-propan-2-ylphenol has a molecular weight of 144.14 g/mol, XLogP of -0.37, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;2-propan-2-ylphenol is sourced from PubChem (CID 175276368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).