C14H24OS — CID 174932639
1,2-di(propan-2-yl)benzene;1-sulfanylethanol (PubChem CID 174932639) has the molecular formula C14H24OS and a molecular weight of 240.41 g/mol. Its IUPAC name is 1,2-di(propan-2-yl)benzene;1-sulfanylethanol.
| Compound Name | 1,2-di(propan-2-yl)benzene;1-sulfanylethanol |
|---|---|
| PubChem CID | 174932639 |
| Molecular Formula | C14H24OS |
| Molecular Weight | 240.41 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 1,2-di(propan-2-yl)benzene;1-sulfanylethanol |
| SMILES | CC(C)c1ccccc1C(C)C.CC(O)S |
| InChI | InChI=1S/C12H18.C2H6OS/c1-9(2)11-7-5-6-8-12(11)10(3)4;1-2(3)4/h5-10H,1-4H3;2-4H,1H3 |
| InChIKey | VUICRWLHIOPNHK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.41 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|