C11H14Cl2O — CID 164892155
2,2-dichloro-1-(2-propan-2-ylphenyl)ethanol (PubChem CID 164892155) has the molecular formula C11H14Cl2O and a molecular weight of 233.14 g/mol. Its IUPAC name is 2,2-dichloro-1-(2-propan-2-ylphenyl)ethanol.
| Compound Name | 2,2-dichloro-1-(2-propan-2-ylphenyl)ethanol |
|---|---|
| PubChem CID | 164892155 |
| Molecular Formula | C11H14Cl2O |
| Molecular Weight | 233.14 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 2,2-dichloro-1-(2-propan-2-ylphenyl)ethanol |
| SMILES | CC(C)c1ccccc1C(O)C(Cl)Cl |
| InChI | InChI=1S/C11H14Cl2O/c1-7(2)8-5-3-4-6-9(8)10(14)11(12)13/h3-7,10-11,14H,1-2H3 |
| InChIKey | FMDBZSPZPGTEJW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.14 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|