C13H19N3O2 — CID 171879302
4-azido-1-(2-propan-2-ylphenyl)butane-1,2-diol (PubChem CID 171879302) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is 4-azido-1-(2-propan-2-ylphenyl)butane-1,2-diol.
| Compound Name | 4-azido-1-(2-propan-2-ylphenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171879302 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 4-azido-1-(2-propan-2-ylphenyl)butane-1,2-diol |
| SMILES | CC(C)c1ccccc1C(O)C(O)CCN=[N+]=[N-] |
| InChI | InChI=1S/C13H19N3O2/c1-9(2)10-5-3-4-6-11(10)13(18)12(17)7-8-15-16-14/h3-6,9,12-13,17-18H,7-8H2,1-2H3 |
| InChIKey | WPAWRYTZPBAMEY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 89.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|