C10H12N6O2 — CID 171879603
4-azido-1-(2-azidophenyl)butane-1,2-diol (PubChem CID 171879603) has the molecular formula C10H12N6O2 and a molecular weight of 248.25 g/mol. Its IUPAC name is 4-azido-1-(2-azidophenyl)butane-1,2-diol.
| Compound Name | 4-azido-1-(2-azidophenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171879603 |
| Molecular Formula | C10H12N6O2 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 4-azido-1-(2-azidophenyl)butane-1,2-diol |
| SMILES | [N-]=[N+]=NCCC(O)C(O)c1ccccc1N=[N+]=[N-] |
| InChI | InChI=1S/C10H12N6O2/c11-15-13-6-5-9(17)10(18)7-3-1-2-4-8(7)14-16-12/h1-4,9-10,17-18H,5-6H2 |
| InChIKey | CWYKWQFMPBEASS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 137.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|