C13H15N3O3 — CID 171879660
4-(4-azido-1,2-dihydroxybutyl)-2,3-dihydroinden-1-one (PubChem CID 171879660) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is 4-(4-azido-1,2-dihydroxybutyl)-2,3-dihydroinden-1-one.
| Compound Name | 4-(4-azido-1,2-dihydroxybutyl)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 171879660 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 4-(4-azido-1,2-dihydroxybutyl)-2,3-dihydroinden-1-one |
| SMILES | [N-]=[N+]=NCCC(O)C(O)c1cccc2c1CCC2=O |
| InChI | InChI=1S/C13H15N3O3/c14-16-15-7-6-12(18)13(19)10-3-1-2-9-8(10)4-5-11(9)17/h1-3,12-13,18-19H,4-7H2 |
| InChIKey | LGWWDRYPLLWVCK-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 106.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|