C12H12O5 — CID 170824156
2,3-dihydroxy-3-(1-oxo-2,3-dihydroinden-4-yl)propanoic acid (PubChem CID 170824156) has the molecular formula C12H12O5 and a molecular weight of 236.22 g/mol. Its IUPAC name is 2,3-dihydroxy-3-(1-oxo-2,3-dihydroinden-4-yl)propanoic acid.
| Compound Name | 2,3-dihydroxy-3-(1-oxo-2,3-dihydroinden-4-yl)propanoic acid |
|---|---|
| PubChem CID | 170824156 |
| Molecular Formula | C12H12O5 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 2,3-dihydroxy-3-(1-oxo-2,3-dihydroinden-4-yl)propanoic acid |
| SMILES | O=C1CCc2c1cccc2C(O)C(O)C(=O)O |
| InChI | InChI=1S/C12H12O5/c13-9-5-4-6-7(9)2-1-3-8(6)10(14)11(15)12(16)17/h1-3,10-11,14-15H,4-5H2,(H,16,17) |
| InChIKey | MTYNOHSWCHDWAX-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |