C13H13NO3 — CID 171901161
3,4-dihydroxy-4-(1-oxo-2,3-dihydroinden-4-yl)butanenitrile (PubChem CID 171901161) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is 3,4-dihydroxy-4-(1-oxo-2,3-dihydroinden-4-yl)butanenitrile.
| Compound Name | 3,4-dihydroxy-4-(1-oxo-2,3-dihydroinden-4-yl)butanenitrile |
|---|---|
| PubChem CID | 171901161 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 3,4-dihydroxy-4-(1-oxo-2,3-dihydroinden-4-yl)butanenitrile |
| SMILES | N#CCC(O)C(O)c1cccc2c1CCC2=O |
| InChI | InChI=1S/C13H13NO3/c14-7-6-12(16)13(17)10-3-1-2-9-8(10)4-5-11(9)15/h1-3,12-13,16-17H,4-6H2 |
| InChIKey | KVRKELDHYSWCTJ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |